FrostBound News

[p]Dear Lords, [/p][p][/p][p]We've made the following adjustments and optimizations:[/p][p][/p][h3]Significant Adjustments[/h3]

1. [p]The new buff Hold Ground[/p]
   1. [p]When the holder enters : Apply +1 Hold Time to the holder.[/p]
2. [p]Exile Cannon-Modified from a Card to a Building.[/p]

[p][/p][h3]Card Updates[/h3]

1. [p]Meditation/Meditation+ Effect Change:[/p]
   1. [p]For each Regenerate the target has, apply +1 Ranged Defense, +3/+4->+4/+5 Health to the target, clear all Regenerate.[/p]
2. [p]Accumulate Virtue/Accumulate Virtue+ Effect Change:[/p]
   1. [p]Supply cost 1->0[/p]
3. [p]Invulnerable to Evil/Invulnerable to Evil+ Effect Rework:[/p]
   1. [p]Good Cause[/p]
   2. [p]Apply +3/+6 Regenerate to the target.[/p]
4. [p]Strike/Strike+ Effect Change:[/p]
   1. [p]Add buff Good Cause[/p]
   2. [p]The target gain +1 Ranged Defense and +8/+10->+2/+5 Counterattack.[/p]
5. [p]Fate/Fate+ Effect Change:[/p]
   1. [p]Supply cost 3/2->2/1[/p]
6. [p]Leader/Leader+ Effect Rework:[/p]
   1. [p]When this card retreats : Pa 6/4 Coin, +1 Armament.[/p]
7. [p]Gold Control Mage/Gold Control Mage+ Effect Change:[/p]
   1. [p]Add buff Eternal[/p]
   2. [p]At the end of monster's turn : If there is a monster in the adjacent column, gain +1/+2->+2/+3 Coin.[/p]
8. [p]Sylvia Effect Rework:[/p]
   1. [p]Whenever an allied Card enters this Card's column : Destroy that card , for each Reputation this card has, apply +1 Bloodthirsty to all allies.[/p]
9. [p]Phase/Phase+ Effect Change:[/p]
   1. [p]Add buff Void[/p]
   2. [p]Supply cost 5/4->4/3[/p]
10. [p]Riemann Effect Change:[/p]
    1. [p]Supply cost 6->5[/p]
11. [p]Sigrid Effect Change:[/p]
    1. [p]Whenever you play a card ： Gain +1->+2 Ranged Power.[/p]
    2. [p]At the end of your turn : Perform a Ranged Attack.[/p]
12. [p]Axiom Law: Condense/Axiom Law: Condense+ Effect Change:[/p]
    1. [p]Supply cost 1->0[/p]
13. [p]Dust Purifier Effect Change:[/p]
    1. [p]Supply cost 6->5[/p]
14. [p]Plunder/Plunder+ Effect Rework:[/p]
    1. [p]If the target's Intention is to advance, gain +2/+3 Fragile, the target Fixed advances once.[/p]
15. [p]Frontline Supply/Frontline Supply+ Effect Rework:[/p]
    1. [p]+3/+5Next Defense Card's Health, gain 1/2 Prisoner.[/p]
16. [p]Dismiss/Dismiss+ Effect Rework:[/p]
    1. [p]Supply cost 1[/p]
    2. [p]Affect ally only[/p]
    3. [p]Destroy target ally, an ally with the highest Ranged Power gains Health equal to Health of the target.[/p]
17. [p]Dismiss Effect Change:[/p]
    1. [p]Add buff Exhaust[/p]
18. [p]Covering Fire+ Effect Change:[/p]
    1. [p]Damage 4->3[/p]
19. [p]Alert Archer+ Effect Change:[/p]
    1. [p]Add buff Hold Ground[/p]
    2. [p]Ranged Power 8->6[/p]
20. [p]Warden/Warden+ Effect Rework:[/p]
    1. [p]Whenever a Prisoner enters : Destroy Prisoner, gain +1 Supply, with a maximum of 2 times each round.[/p]
21. [p]Warden+ Effect Change:[/p]
    1. [p]Add buff Hold Ground[/p]
22. [p]Wild Hunter/Wild Hunter+ Effect Rework:[/p]
    1. [p]Whenever an allied Card enters this Card's column: Destroy that card, apply +1 Ranged Power to all allies, with a maximum of 2 times each round.[/p]
23. [p]Wild Hunter+ Effect Change:[/p]
    1. [p]Add buff Hold Ground[/p]
24. [p]Ashen Vanguard/Ashen Vanguard+ Effect Rework:[/p]
    1. [p]When an ally is destroyed : Random an ally performs a Ranged Attack[/p]
25. [p]Ashen Vanguard+ Effect Change:[/p]
    1. [p]Add buff Hold Ground[/p]
26. [p]Flame Spirit Priest+ Effect Change:[/p]
    1. [p]Add buff Hold Ground[/p]
27. [p]Special Provision Squad+ Effect Change:[/p]
    1. [p]Add buff Hold Ground[/p]
    2. [p]Health 10->1[/p]
28. [p]Conscription/Conscription+ Effect Rework:[/p]
    1. [p]Exhaust[/p]
    2. [p]Gain 4/6 Prisoner.[/p]
29. [p]Cover/Cover+ -> Break Through/Break Through+ Change Name and Effect Rework:[/p]
    1. [p]Affect ally only[/p]
    2. [p]Gain a Prisoner, deal 10 damage to the target.[/p]
    3. [p]Echo 4.[/p]
30. [p]Convergence of Stars/Convergence of Stars+ Effect Rework:[/p]
    1. [p]Destroy all monsters on the field with less than 32/40 Health.[/p]
31. [p]Monster Card-Ghoul Spitter Effect Change:[/p]
    1. [p]Health 48->30[/p]
32. [p]Monster Card-Ghoul Evolver Effect Change:[/p]
    1. [p]Health 90->110[/p]

[p][/p][h3]Bug Fixes[/h3]

1. [p]Fixed the inconsistency between the description and effect of the "Gareth".[/p]
2. [p]Fixed the description issue of the "Altar".[/p]
3. [p]Fixed the buff of the "Cursemancer".[/p]
4. [p]Fixed the issue with the position of the card block on the settlement page[/p]
5. [p]Fixed the display issue of the health points of the "White Knight".[/p]
6. [p]Fixed the special effects issue of "Voltar".[/p]
7. [p]Fixed the Building in the store would affect the Building Design.[/p]
8. [p]Fixed the issue of the desktop card's health value UI display.[/p]
9. [p]Fixed the issue of no elites in the store[/p]
10. [p]Increased the probability of high rarity in card selection+/card selection++[/p]

[p][/p][h3]Performance Optimization[/h3]

1. [p]Adjust the card order on the settlement interface at the end of the game.[/p]

[p][/p][p]As a beta version, we know there are still many issues to discover and resolve. We are incredibly grateful for your support and feedback![/p][p]Enjoy the game![/p][p][/p][p]Lyra Studio[/p][p][/p][p]P.S. Join our \Discord\ to discuss everything about the game anytime! To stay updated on the latest news, don't forget to follow us on social media:[/p][p][/p][p]Discord: https://discord.gg/RrU7ZXxSPX[/p][p]X / Twitter: https://x.com/lyrastudiogames[/p][p][/p]

[p]Dear Lords,

In preparation of the Steam Next Fest, we've rolled out a major update. We welcome both new and returning players to experience our brand-new Demo![/p][p][/p][h3]Significant Adjustments[/h3]

1. [p]Summoned monsters no longer take immediate action when entering the battlefield.[/p]
2. [p]After a game concludes, players will now see a comprehensive overview of their game statistics, including:[/p]
   1. [p]Selected Hero[/p]
   2. [p]Deck Overview[/p]
   3. [p]Buildings Overview[/p]
   4. [p]Runes Overview[/p]
   5. [p]Battles Data[/p][p][/p]
3. [p]Optimized the description of Hero Fate.[/p]
   1. [p](Note: Cards without ranged attack power will not have their defense reduced due to the effects of Fate.)[/p][p][/p]

[h3]Card Updates[/h3]

1. [p]Special Provision Squad Effect Change:[/p]
   1. [p]Add buff Exhaust.[/p]
   2. [p]Supply cost 2->1.[/p]
2. [p]Broken Vow+ Effect Rework:[/p]
   1. [p]Apply -7 Ranged Defend to target -> Apply -8 Ranged Defend to target.[/p]
3. [p]Good Cause Recorder/Good Cause Recorder+ Effect Change:[/p]
   1. [p]When it enters, Pay 1 Good karma card: Next turn gain +2 Supply / Gain +1 Supply and next turn gain +1 Supply.[/p]
4. [p]Good Samaritan/Good Samaritan+ Effect Change:[/p]
   1. [p]Supply cost 2->1.[/p]
5. [p]Good Samaritan Effect Change:[/p]
   1. [p]When it enters: All Cards in the same Column gain +6 Health -> gain +2 Health.[/p]
6. [p]Guardian/Guardian+ Effect Change:[/p]
   1. [p]Supply cost 1->0.[/p]
7. [p]Hand of Doom/Hand of Doom+ Effect Rework:[/p]
   1. [p]Choose and Exhaust a Curse Card: gain +2 Supply, apply -3 Ranged Defend to target / apply -8 Ranged Defend to target.[/p]
8. [p]Corruptionl/Corruption+ Effect Change:[/p]
   1. [p]For each Curse Card in your Deck and Exhaust Pile, apply -1 Ranged Defend to target -> For each Curse Card in your Deck and Exhaust Pile, apply -1 Ranged Defend and -1 Ranged Damage to target.[/p]
9. [p]Spirit Gold/Spirit Gold+ Effect Rework:[/p]
   1. [p]Spirit Gold On Kill: gain +4 Coin.[/p]
   2. [p]Spirit Gold+ On Kill, Pay 6 Coin: each turn gain +1 Supply.[/p]
10. [p]Element Absorption/Element Absorption+ Effect Change:[/p]
    1. [p]Damage 3/5 -> 2/4.[/p]
11. [p]Element Absorption Effect Change:[/p]
    1. [p]On Kill: Draw 2 cards -> Draw 1 card, next turn draw +1 extra card.[/p]
12. [p]Sword of Pacification Effect Rework:[/p]
    1. [p]0 Supply, 10 Damage.[/p]
    2. [p]If the target's Intention is Ranged Attack, attack 2 more times.[/p]
13. [p]Fragile Golden Sword Effect Change:[/p]
    1. [p]Add buff Void.[/p]
14. [p]The Power of the Clockkeeper Effect Change:[/p]
    1. [p]Add buff Void.[/p]
15. [p]Exile Trade Office Effect Change:[/p]
    1. [p]Change Faction to Ally.[/p]
16. [p]Anchor of Rebirth Effect Change:[/p]
    1. [p]Change Faction to Ally.[/p]
17. [p]Monster Card - Caravan Commander Effect Change:[/p]
    1. [p]Whenever you play a card: gain +1 Mana (max 12 -> 15 times per turn).[/p]
    2. [p]If Mana is 4 -> 5 or greater, this card acts once and loses 4 -> 5 Mana.[/p]
18. [p]Monster Card - Flesh Warehouse Effect Change:[/p]
    1. [p]Health 60 -> 80.[/p]
    2. [p]At the end of your turn -> At the end of the monster's turn: Summon 1 Flesh Golem in the same Column.[/p][p][/p]

[h3]Bug Fixes[/h3]

1. [p]Fixed the mismatch between the description and actual effect of the "Final Gladiatorial Showdown" event.[/p]
2. [p]Fixed the inconsistency between the description and effect of the "Steam Catapult" / "Steam Catapult+".[/p]
3. [p]Fixed the discrepancy between the effect and description of the "Element Absorption+".[/p]
4. [p]Fixed the issue where the "Death Knell" event could not proceed normally.[/p]
5. [p]Fixed the issue where the "Archmage" did not appear in the process as intended.[/p]
6. [p]Fixed text errors in some events.[/p]
7. [p]Fixed some English text errors.[/p]

[h3]Performance Optimization[/h3]

1. [p]Added exclusive BGM to certain Calamity battles.[/p]

[p]
As a beta version, we know there are still many issues to discover and resolve. We are incredibly grateful for your support and feedback!
Enjoy the game!

Lyra Studio

P.S. Join our Discord to discuss everything about the game anytime! To stay updated on the latest news, don't forget to follow us on social media:

Discord: https://discord.gg/RrU7ZXxSPX
X / Twitter: https://x.com/lyrastudiogames[/p]

[p]Dear Players！[/p][p][/p][p]We’re thrilled to announce that FrostBound will be participating in the upcoming June Steam Next Fest! Since the May Demo launch, our game’s median playtime has reached 1 hour and 11 minutes, with the average playtime hitting an impressive 3 hours and 40 minutes! We’re excited for every player who’s immersed themselves in the game, and we sincerely thank everyone for their feedback—it’s driving us to continually improve and push forward![/p][p][/p][p]If this is your first time trying FrostBound, don’t worry! It’s an easy-to-learn, hard-to-master roguelike deck-building card game. Let me explain its rules to you in 5 simple sentences.[/p]

1. [p]In the game, you play as a lord defending against disasters amid an endless winter. Each run gives you 3 Integrity points (health). Failing a regular battle costs you 1 point (we’ve kindly given you three chances!), but losing a boss fight will immediately end your run.[/p]
2. [p]Your battlefield is a 7-column grid, with 6 columns available for deployment. If any enemy crosses your leftmost defense line, the battle ends in failure (See? I told you it’s simple).[/p][p][/p]
3. [p]You’ve got plenty of ways to fight! The game offers Attack cards that deal direct damage to cards on the field, Defense cards that can be deployed in your lanes or neutral lanes, and Skill cards with various unique mechanics to build your deck. On top of that, powerful Structure cards (think of them like Relics in other card games) provide unexpected support.[/p][p][/p]
4. [p]Each disaster monster has health, defense, and even ranged attack and magic power. You’ll need to develop strategies based on their unique traits.[/p][p][/p]
5. [p]Keep in mind that due to the freezing weather, regular defensive warriors will retreat after one turn. Only sturdy structures and steadfast elite units can withstand the harsh cold and hold the battlefield.[/p][p][/p]

[p]Now, you’re ready to become a lord! It’s time to defend your own territory. Add FrostBound to your wishlist now, and start building your unique deck in the Demo![/p][p][dynamiclink][/dynamiclink][/p]

Dear Lords,

We've made the following bug fixes and optimizations:

[h3]Bug Fixes[/h3]

1. Fixed the issue where "Magic Thoughts" was not immortal.
   
2. Fixed the incorrect description of "Construction Hub" in English.
   
3. Fixed the problem where "Fate+" had no associated cards.
   
4. Fixed the bug where "Overload" could draw non-elite cards.
   
5. Fixed the mismatch between the effect and description of "Plunder+".
   
6. Fixed the issue where rewards were not correctly distributed after winning the "Lost Remains" battle.
   

[h3]Card Updates[/h3]

1. Zone Lockdown+: Effect changed - When a target is killed, add a Pursuit Enchantment to the column of the target.
   
2. Battlefield Scavenging+: Supply requirement reduced from 1 to 0.
   
3. Exile Trade Office: Effect changed - At the end of your turn, if supply is not 0, gain 10 gold (from 5).
   

As a beta version, we know there are still many issues to discover and resolve. We are incredibly grateful for your support and feedback!
Enjoy the game!

Lyra Studio

Dear Lords,

We've made the following adjustments and optimizations:

[h3]Card Balance Adjustments[/h3]

1. Plunder : Enhanced.
   
2. Gold Control Mage : Enhanced.
   
3. Monetary Onslaught : Enhanced.
   
4. Heart Attachment : Enhanced.
   
5. Magic Thoughts : Enhanced.
   
6. Spiritualist : Enhanced.
   
7. Convergence of Stars : Enhanced.
   
8. Storm Monk : Enhanced.
   
9. Energy Conversion : Enhanced.
   
10. Squander : Enhanced.
    
11. Deduction : Enhanced.
    
12. Supplier : Rebalanced.
    
13. Overload : Rebalanced.
    
14. Gold Hound : Weakened.
    
15. Deconstruct : Weakened.
    
16. White Hermit : Weakened.
    

[h3]Game Experience Optimizations[/h3]

1. Optimized some icons and VFX, fixing the bug where hero statue VFX was missing.
   
2. Improved life value display to icon format.
   
3. Adjusted strategic objective Buffs.
   
4. Optimized card descriptions.
   
5. Speed up the animation for creature recovery after taking damage.
   
6. Faster rune settlement animation speed.
   

As a beta version, we know there are still many issues to discover and resolve. We are incredibly grateful for your support and feedback!
Enjoy the game!

Lyra Studio